C25H40F4N4O3 — CID 139471289
1-[[4-[4-[2-(2-fluoro-2-methylpropoxy)ethyl]piperazin-1-yl]oxan-4-yl]methyl-[6-(trifluoromethyl)-2-pyridinyl]amino]propan-1-ol (PubChem CID 139471289) has the molecular formula C25H40F4N4O3 and a molecular weight of 520.61 g/mol. Its IUPAC name is 1-[[4-[4-[2-(2-fluoro-2-methylpropoxy)ethyl]piperazin-1-yl]oxan-4-yl]methyl-[6-(trifluoromethyl)-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 1-[[4-[4-[2-(2-fluoro-2-methylpropoxy)ethyl]piperazin-1-yl]oxan-4-yl]methyl-[6-(trifluoromethyl)-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 139471289 |
| Molecular Formula | C25H40F4N4O3 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 1-[[4-[4-[2-(2-fluoro-2-methylpropoxy)ethyl]piperazin-1-yl]oxan-4-yl]methyl-[6-(trifluoromethyl)-2-pyridinyl]amino]propan-1-ol |
| SMILES | CCC(O)N(CC1(N2CCN(CCOCC(C)(C)F)CC2)CCOCC1)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C25H40F4N4O3/c1-4-22(34)33(21-7-5-6-20(30-21)25(27,28)29)18-24(8-15-35-16-9-24)32-12-10-31(11-13-32)14-17-36-19-23(2,3)26/h5-7,22,34H,4,8-19H2,1-3H3 |
| InChIKey | ICFKDPLVZXPHOR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|