About 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol
1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol (PubChem CID 139471458) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol.
Molecular Properties
| Compound Name | 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol |
| PubChem CID | 139471458 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol |
| SMILES | C=C(O)C1=CC(NC)=CC=CC1 |
| InChI | InChI=1S/C10H13NO/c1-8(12)9-5-3-4-6-10(7-9)11-2/h3-4,6-7,11-12H,1,5H2,2H3 |
| InChIKey | CILXUCNULJRXMO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol?
The IUPAC name of 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol (CID 139471458) is 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol.
What is the SMILES notation for 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol?
The canonical SMILES for 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol is C=C(O)C1=CC(NC)=CC=CC1.
What is the InChIKey of 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol?
The InChIKey is CILXUCNULJRXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-8(12)9-5-3-4-6-10(7-9)11-2/h3-4,6-7,11-12H,1,5H2,2H3.
What are the key properties of 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol?
1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol has a molecular weight of 163.22 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenol is sourced from PubChem (CID 139471458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).