About [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine
[(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine (PubChem CID 139471525) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine.
Molecular Properties
| Compound Name | [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine |
| PubChem CID | 139471525 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine |
| SMILES | C=C(/C=C(CC)\C(C)=C/C)CCNN |
| InChI | InChI=1S/C12H22N2/c1-5-11(4)12(6-2)9-10(3)7-8-14-13/h5,9,14H,3,6-8,13H2,1-2,4H3/b11-5-,12-9- |
| InChIKey | CKGVVZXBCHXXGE-VSYNPXDPSA-N |
| XLogP | 2.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine?
The IUPAC name of [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine (CID 139471525) is [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine.
What is the SMILES notation for [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine?
The canonical SMILES for [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine is C=C(/C=C(CC)\C(C)=C/C)CCNN.
What is the InChIKey of [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine?
The InChIKey is CKGVVZXBCHXXGE-VSYNPXDPSA-N. The full InChI is InChI=1S/C12H22N2/c1-5-11(4)12(6-2)9-10(3)7-8-14-13/h5,9,14H,3,6-8,13H2,1-2,4H3/b11-5-,12-9-.
What are the key properties of [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine?
[(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine has a molecular weight of 194.32 g/mol, XLogP of 2.70, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z,6Z)-5-ethyl-6-methyl-3-methylideneocta-4,6-dienyl]hydrazine is sourced from PubChem (CID 139471525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).