C14H25FN2 — CID 139471562
(3E,5Z)-4-fluoro-3-(methylideneamino)-N,N-dipropylhepta-3,5-dien-1-amine (PubChem CID 139471562) has the molecular formula C14H25FN2 and a molecular weight of 240.37 g/mol. Its IUPAC name is (3E,5Z)-4-fluoro-3-(methylideneamino)-N,N-dipropylhepta-3,5-dien-1-amine.
| Compound Name | (3E,5Z)-4-fluoro-3-(methylideneamino)-N,N-dipropylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 139471562 |
| Molecular Formula | C14H25FN2 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | (3E,5Z)-4-fluoro-3-(methylideneamino)-N,N-dipropylhepta-3,5-dien-1-amine |
| SMILES | C=N/C(CCN(CCC)CCC)=C(F)\C=C/C |
| InChI | InChI=1S/C14H25FN2/c1-5-8-13(15)14(16-4)9-12-17(10-6-2)11-7-3/h5,8H,4,6-7,9-12H2,1-3H3/b8-5-,14-13+ |
| InChIKey | LHFVHOVSENQMHS-FCBYNYORSA-N |
| XLogP | 3.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|