C13H18O2 — CID 139471607
4-[(3E,5E)-6-hydroxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-ol (PubChem CID 139471607) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 4-[(3E,5E)-6-hydroxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-ol.
| Compound Name | 4-[(3E,5E)-6-hydroxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 139471607 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-[(3E,5E)-6-hydroxyhepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-ol |
| SMILES | CC/C(=C\C=C(/C)O)C1=CC=C(O)CC1 |
| InChI | InChI=1S/C13H18O2/c1-3-11(5-4-10(2)14)12-6-8-13(15)9-7-12/h4-6,8,14-15H,3,7,9H2,1-2H3/b10-4+,11-5+ |
| InChIKey | RFDUGCXFWJQTAO-ZVSIBQGLSA-N |
| XLogP | 3.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|