C9H12F3NS — CID 139471611
(3Z,5E)-6-ethylsulfanyl-1,1,1-trifluoro-N-methylhexa-3,5-dien-2-imine (PubChem CID 139471611) has the molecular formula C9H12F3NS and a molecular weight of 223.26 g/mol. Its IUPAC name is (3Z,5E)-6-ethylsulfanyl-1,1,1-trifluoro-N-methylhexa-3,5-dien-2-imine.
| Compound Name | (3Z,5E)-6-ethylsulfanyl-1,1,1-trifluoro-N-methylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 139471611 |
| Molecular Formula | C9H12F3NS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | (3Z,5E)-6-ethylsulfanyl-1,1,1-trifluoro-N-methylhexa-3,5-dien-2-imine |
| SMILES | CCS/C=C/C=C\C(=N\C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NS/c1-3-14-7-5-4-6-8(13-2)9(10,11)12/h4-7H,3H2,1-2H3/b6-4-,7-5+,13-8- |
| InChIKey | XWHHBILJEVKCDP-RFGGABNVSA-N |
| XLogP | 3.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|