C6H6F3N5 — CID 139471727
5-(2,2,2-trifluoroethanimidoyl)pyrimidine-4,6-diamine (PubChem CID 139471727) has the molecular formula C6H6F3N5 and a molecular weight of 205.14 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethanimidoyl)pyrimidine-4,6-diamine.
| Compound Name | 5-(2,2,2-trifluoroethanimidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 139471727 |
| Molecular Formula | C6H6F3N5 |
| Molecular Weight | 205.14 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 5-(2,2,2-trifluoroethanimidoyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(/c1c(N)ncnc1N)C(F)(F)F |
| InChI | InChI=1S/C6H6F3N5/c7-6(8,9)3(10)2-4(11)13-1-14-5(2)12/h1,10H,(H4,11,12,13,14)/b10-3- |
| InChIKey | IPYJZIWMOGCLSS-KMKOMSMNSA-N |
| XLogP | 0.57 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.14 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|