C9H16N2S — CID 139472033
2-butylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole (PubChem CID 139472033) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 2-butylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole.
| Compound Name | 2-butylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 139472033 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-butylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
| SMILES | CCCC=C1NC2CSCC2N1 |
| InChI | InChI=1S/C9H16N2S/c1-2-3-4-9-10-7-5-12-6-8(7)11-9/h4,7-8,10-11H,2-3,5-6H2,1H3 |
| InChIKey | VUSSXYFIIYLGTP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |