C50H74O14 — CID 139472243
[14-acetyloxy-2-(buta-1,3-dien-2-yloxymethyl)-9-methylidene-6-(7-prop-2-enoyloxyhept-1-en-2-yloxymethyl)-2,6-bis(prop-2-enoyloxymethyl)tetradecyl] 6-prop-2-enoyloxyhexanoate (PubChem CID 139472243) has the molecular formula C50H74O14 and a molecular weight of 899.13 g/mol. Its IUPAC name is [14-acetyloxy-2-(buta-1,3-dien-2-yloxymethyl)-9-methylidene-6-(7-prop-2-enoyloxyhept-1-en-2-yloxymethyl)-2,6-bis(prop-2-enoyloxymethyl)tetradecyl] 6-prop-2-enoyloxyhexanoate.
| Compound Name | [14-acetyloxy-2-(buta-1,3-dien-2-yloxymethyl)-9-methylidene-6-(7-prop-2-enoyloxyhept-1-en-2-yloxymethyl)-2,6-bis(prop-2-enoyloxymethyl)tetradecyl] 6-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 139472243 |
| Molecular Formula | C50H74O14 |
| Molecular Weight | 899.13 g/mol |
| Exact Mass | 898.51 |
| IUPAC Name | [14-acetyloxy-2-(buta-1,3-dien-2-yloxymethyl)-9-methylidene-6-(7-prop-2-enoyloxyhept-1-en-2-yloxymethyl)-2,6-bis(prop-2-enoyloxymethyl)tetradecyl] 6-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=C)OCC(CCCC(CCC(=C)CCCCCOC(C)=O)(COC(=C)CCCCCOC(=O)C=C)COC(=O)C=C)(COC(=O)C=C)COC(=O)CCCCCOC(=O)C=C |
| InChI | InChI=1S/C50H74O14/c1-10-41(7)60-37-50(38-63-47(55)14-5,39-64-48(56)27-20-17-23-34-59-45(53)12-3)30-24-29-49(36-62-46(54)13-4,31-28-40(6)25-18-15-21-32-57-43(9)51)35-61-42(8)26-19-16-22-33-58-44(52)11-2/h10-14H,1-8,15-39H2,9H3 |
| InChIKey | XOZDLCRXPYABGB-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.13 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|