C26H25ClF2N6O — CID 139472442
[4-amino-3-(2-chloropyridine-4-carboximidoyl)benzenecarboximidoyl] 1-[(2,6-difluorophenyl)methyl]piperidine-3-carboximidate (PubChem CID 139472442) has the molecular formula C26H25ClF2N6O and a molecular weight of 510.98 g/mol. Its IUPAC name is [4-amino-3-(2-chloropyridine-4-carboximidoyl)benzenecarboximidoyl] 1-[(2,6-difluorophenyl)methyl]piperidine-3-carboximidate.
| Compound Name | [4-amino-3-(2-chloropyridine-4-carboximidoyl)benzenecarboximidoyl] 1-[(2,6-difluorophenyl)methyl]piperidine-3-carboximidate |
|---|---|
| PubChem CID | 139472442 |
| Molecular Formula | C26H25ClF2N6O |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | [4-amino-3-(2-chloropyridine-4-carboximidoyl)benzenecarboximidoyl] 1-[(2,6-difluorophenyl)methyl]piperidine-3-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])C1CCCN(Cc2c(F)cccc2F)C1)c1ccc(N)c(/C(=N/[H])c2ccnc(Cl)c2)c1 |
| InChI | InChI=1S/C26H25ClF2N6O/c27-23-12-15(8-9-34-23)24(31)18-11-16(6-7-22(18)30)25(32)36-26(33)17-3-2-10-35(13-17)14-19-20(28)4-1-5-21(19)29/h1,4-9,11-12,17,31-33H,2-3,10,13-14,30H2/b31-24+,32-25-,33-26+ |
| InChIKey | SXNKLXZKIQBUAM-GDERXPNDSA-N |
| XLogP | 5.24 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|