About 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine
1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine (PubChem CID 139472620) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine |
| PubChem CID | 139472620 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine |
| SMILES | C=C(NC(C)CC1=CC=CCC1)c1cnccn1 |
| InChI | InChI=1S/C15H19N3/c1-12(10-14-6-4-3-5-7-14)18-13(2)15-11-16-8-9-17-15/h3-4,6,8-9,11-12,18H,2,5,7,10H2,1H3 |
| InChIKey | DVPWFARKRVZSES-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine?
The IUPAC name of 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine (CID 139472620) is 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine is C=C(NC(C)CC1=CC=CCC1)c1cnccn1.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine?
The InChIKey is DVPWFARKRVZSES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3/c1-12(10-14-6-4-3-5-7-14)18-13(2)15-11-16-8-9-17-15/h3-4,6,8-9,11-12,18H,2,5,7,10H2,1H3.
What are the key properties of 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine?
1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine has a molecular weight of 241.34 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-yl-N-(1-pyrazin-2-ylethenyl)propan-2-amine is sourced from PubChem (CID 139472620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).