C13H18F2O — CID 139472674
[(1Z,3E)-1,2-difluorohexa-1,3,5-trien-3-yl]oxymethylcyclohexane (PubChem CID 139472674) has the molecular formula C13H18F2O and a molecular weight of 228.28 g/mol. Its IUPAC name is [(1Z,3E)-1,2-difluorohexa-1,3,5-trien-3-yl]oxymethylcyclohexane.
| Compound Name | [(1Z,3E)-1,2-difluorohexa-1,3,5-trien-3-yl]oxymethylcyclohexane |
|---|---|
| PubChem CID | 139472674 |
| Molecular Formula | C13H18F2O |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [(1Z,3E)-1,2-difluorohexa-1,3,5-trien-3-yl]oxymethylcyclohexane |
| SMILES | C=C/C=C(OCC1CCCCC1)\C(F)=C\F |
| InChI | InChI=1S/C13H18F2O/c1-2-6-13(12(15)9-14)16-10-11-7-4-3-5-8-11/h2,6,9,11H,1,3-5,7-8,10H2/b12-9-,13-6+ |
| InChIKey | VCHHBXBZWRPJMM-ODXTVASYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|