C25H30O4 — CID 139473530
(3R,3aR,5S,7aS)-5-hydroxy-5-(1-methylcyclohexyl)-3-naphthalen-2-yloxy-3,3a,4,6,7,7a-hexahydro-2-benzofuran-1-one (PubChem CID 139473530) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (3R,3aR,5S,7aS)-5-hydroxy-5-(1-methylcyclohexyl)-3-naphthalen-2-yloxy-3,3a,4,6,7,7a-hexahydro-2-benzofuran-1-one.
| Compound Name | (3R,3aR,5S,7aS)-5-hydroxy-5-(1-methylcyclohexyl)-3-naphthalen-2-yloxy-3,3a,4,6,7,7a-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139473530 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (3R,3aR,5S,7aS)-5-hydroxy-5-(1-methylcyclohexyl)-3-naphthalen-2-yloxy-3,3a,4,6,7,7a-hexahydro-2-benzofuran-1-one |
| SMILES | CC1([C@]2(O)CC[C@@H]3C(=O)O[C@@H](Oc4ccc5ccccc5c4)[C@@H]3C2)CCCCC1 |
| InChI | InChI=1S/C25H30O4/c1-24(12-5-2-6-13-24)25(27)14-11-20-21(16-25)23(29-22(20)26)28-19-10-9-17-7-3-4-8-18(17)15-19/h3-4,7-10,15,20-21,23,27H,2,5-6,11-14,16H2,1H3/t20-,21+,23+,25-/m0/s1 |
| InChIKey | ATZTUYMKHPLGSL-JIEYXDDVSA-N |
| XLogP | 5.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |