About (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine
(2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine (PubChem CID 139473668) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine.
Molecular Properties
| Compound Name | (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine |
| PubChem CID | 139473668 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine |
| SMILES | C/N=C1\C(C)=CS\C1=C/C(C)C |
| InChI | InChI=1S/C10H15NS/c1-7(2)5-9-10(11-4)8(3)6-12-9/h5-7H,1-4H3/b9-5-,11-10+ |
| InChIKey | YOPXYDWUNQBIPC-CLYWSLGHSA-N |
| XLogP | 3.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine?
The IUPAC name of (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine (CID 139473668) is (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine.
What is the SMILES notation for (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine?
The canonical SMILES for (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine is C/N=C1\C(C)=CS\C1=C/C(C)C.
What is the InChIKey of (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine?
The InChIKey is YOPXYDWUNQBIPC-CLYWSLGHSA-N. The full InChI is InChI=1S/C10H15NS/c1-7(2)5-9-10(11-4)8(3)6-12-9/h5-7H,1-4H3/b9-5-,11-10+.
What are the key properties of (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine?
(2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine has a molecular weight of 181.30 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N,4-dimethyl-2-(2-methylpropylidene)thiophen-3-imine is sourced from PubChem (CID 139473668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).