About 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine
5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine (PubChem CID 139473829) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine.
Analyze 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine?
The IUPAC name of 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine (CID 139473829) is 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine.
What is the SMILES notation for 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine?
The canonical SMILES for 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine is C/C=C\C1=C(N)NCCC1.
What is the InChIKey of 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine?
The InChIKey is CJXHEXWJADOCNR-RQOWECAXSA-N. The full InChI is InChI=1S/C8H14N2/c1-2-4-7-5-3-6-10-8(7)9/h2,4,10H,3,5-6,9H2,1H3/b4-2-.
What are the key properties of 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine?
5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine has a molecular weight of 138.21 g/mol, XLogP of 1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydropyridin-6-amine is sourced from PubChem (CID 139473829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).