C26H22Cl2N4O2 — CID 139473914
1-[(3S)-3-[3-[4-(2,3-dichlorophenoxy)phenyl]pyrazolo[4,3-c]pyridin-2-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 139473914) has the molecular formula C26H22Cl2N4O2 and a molecular weight of 493.39 g/mol. Its IUPAC name is 1-[(3S)-3-[3-[4-(2,3-dichlorophenoxy)phenyl]pyrazolo[4,3-c]pyridin-2-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[3-[4-(2,3-dichlorophenoxy)phenyl]pyrazolo[4,3-c]pyridin-2-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139473914 |
| Molecular Formula | C26H22Cl2N4O2 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1-[(3S)-3-[3-[4-(2,3-dichlorophenoxy)phenyl]pyrazolo[4,3-c]pyridin-2-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H](n2nc3ccncc3c2-c2ccc(Oc3cccc(Cl)c3Cl)cc2)C1 |
| InChI | InChI=1S/C26H22Cl2N4O2/c1-2-24(33)31-14-4-5-18(16-31)32-26(20-15-29-13-12-22(20)30-32)17-8-10-19(11-9-17)34-23-7-3-6-21(27)25(23)28/h2-3,6-13,15,18H,1,4-5,14,16H2/t18-/m0/s1 |
| InChIKey | VTDPLYLNDWONGX-SFHVURJKSA-N |
| XLogP | 6.55 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|