C19H16N4O2 — CID 139474090
1-(3,4,5,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaen-13-yl)pentane-1,4-dione (PubChem CID 139474090) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-(3,4,5,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaen-13-yl)pentane-1,4-dione.
| Compound Name | 1-(3,4,5,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaen-13-yl)pentane-1,4-dione |
|---|---|
| PubChem CID | 139474090 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(3,4,5,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaen-13-yl)pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)N1c2ccccc2-c2n[nH]nc2-c2ccccc21 |
| InChI | InChI=1S/C19H16N4O2/c1-12(24)10-11-17(25)23-15-8-4-2-6-13(15)18-19(21-22-20-18)14-7-3-5-9-16(14)23/h2-9H,10-11H2,1H3,(H,20,21,22) |
| InChIKey | BSSDNOVJAHTZEO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |