C18H24N4O4 — CID 139474208
1-[2-[(1R,5S)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 139474208) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-[2-[(1R,5S)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[(1R,5S)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139474208 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-[2-[(1R,5S)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | CC(C)=CCN1C(=O)[C@@H]2CC[C@H]1CN(C(=O)Cn1ccc(=O)[nH]c1=O)C2 |
| InChI | InChI=1S/C18H24N4O4/c1-12(2)5-8-22-14-4-3-13(17(22)25)9-21(10-14)16(24)11-20-7-6-15(23)19-18(20)26/h5-7,13-14H,3-4,8-11H2,1-2H3,(H,19,23,26)/t13-,14+/m1/s1 |
| InChIKey | RUGILMQIHIEKNG-KGLIPLIRSA-N |
| XLogP | -0.05 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|