C17H27N3O3S — CID 139474234
1-[(4aR,8aS)-1-(3-methylsulfanylpropyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]cyclopropane-1-carboxamide (PubChem CID 139474234) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-[(4aR,8aS)-1-(3-methylsulfanylpropyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[(4aR,8aS)-1-(3-methylsulfanylpropyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 139474234 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-[(4aR,8aS)-1-(3-methylsulfanylpropyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]cyclopropane-1-carboxamide |
| SMILES | CSCCCN1C(=O)CC[C@@H]2CN(C(=O)C3(C(N)=O)CC3)CC[C@@H]21 |
| InChI | InChI=1S/C17H27N3O3S/c1-24-10-2-8-20-13-5-9-19(11-12(13)3-4-14(20)21)16(23)17(6-7-17)15(18)22/h12-13H,2-11H2,1H3,(H2,18,22)/t12-,13+/m1/s1 |
| InChIKey | ABEZXBAYAQBCFU-OLZOCXBDSA-N |
| XLogP | 0.84 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|