C25H38O4 — CID 139474238
17-(2-hydroxyacetyl)-10,13-dimethyl-17-[(2-methylpropan-2-yl)oxy]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 139474238) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 17-(2-hydroxyacetyl)-10,13-dimethyl-17-[(2-methylpropan-2-yl)oxy]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(2-hydroxyacetyl)-10,13-dimethyl-17-[(2-methylpropan-2-yl)oxy]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 139474238 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 17-(2-hydroxyacetyl)-10,13-dimethyl-17-[(2-methylpropan-2-yl)oxy]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)(C)OC1(C(=O)CO)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C25H38O4/c1-22(2,3)29-25(21(28)15-26)13-10-20-18-7-6-16-14-17(27)8-11-23(16,4)19(18)9-12-24(20,25)5/h14,18-20,26H,6-13,15H2,1-5H3 |
| InChIKey | NGPSIAXONGJFRA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |