C102H122O4 — CID 139474341
2,6-bis[4-tert-butyl-2,6-bis[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]phenyl]anthracene (PubChem CID 139474341) has the molecular formula C102H122O4 and a molecular weight of 1412.09 g/mol. Its IUPAC name is 2,6-bis[4-tert-butyl-2,6-bis[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]phenyl]anthracene.
| Compound Name | 2,6-bis[4-tert-butyl-2,6-bis[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]phenyl]anthracene |
|---|---|
| PubChem CID | 139474341 |
| Molecular Formula | C102H122O4 |
| Molecular Weight | 1412.09 g/mol |
| Exact Mass | 1410.93 |
| IUPAC Name | 2,6-bis[4-tert-butyl-2,6-bis[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]phenyl]anthracene |
| SMILES | COc1c(C(C)(C)C)cc(C#Cc2cc(C(C)(C)C)cc(C#Cc3cc(C(C)(C)C)c(OC)c(C(C)(C)C)c3)c2-c2ccc3cc4cc(-c5c(C#Cc6cc(C(C)(C)C)c(OC)c(C(C)(C)C)c6)cc(C(C)(C)C)cc5C#Cc5cc(C(C)(C)C)c(OC)c(C(C)(C)C)c5)ccc4cc3c2)cc1C(C)(C)C |
| InChI | InChI=1S/C102H122O4/c1-93(2,3)77-59-71(39-35-63-47-79(95(7,8)9)89(103-31)80(48-63)96(10,11)12)87(72(60-77)40-36-64-49-81(97(13,14)15)90(104-32)82(50-64)98(16,17)18)69-45-43-67-56-76-58-70(46-44-68(76)55-75(67)57-69)88-73(41-37-65-51-83(99(19,20)21)91(105-33)84(52-65)100(22,23)24)61-78(94(4,5)6)62-74(88)42-38-66-53-85(101(25,26)27)92(106-34)86(54-66)102(28,29)30/h43-62H,1-34H3 |
| InChIKey | MQTAWDKBPMZRKU-UHFFFAOYSA-N |
| XLogP | 25.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 106 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1412.09 |
| LogP ≤ 5 | 25.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|