About N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine
N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine (PubChem CID 139474349) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine |
| PubChem CID | 139474349 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine |
| SMILES | CC(C)OC1=CC=C(N(C)C(C)C)C(C)C1 |
| InChI | InChI=1S/C14H25NO/c1-10(2)15(6)14-8-7-13(9-12(14)5)16-11(3)4/h7-8,10-12H,9H2,1-6H3 |
| InChIKey | VSXJSOUQMALZGD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine?
The IUPAC name of N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine (CID 139474349) is N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine?
The canonical SMILES for N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine is CC(C)OC1=CC=C(N(C)C(C)C)C(C)C1.
What is the InChIKey of N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine?
The InChIKey is VSXJSOUQMALZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-10(2)15(6)14-8-7-13(9-12(14)5)16-11(3)4/h7-8,10-12H,9H2,1-6H3.
What are the key properties of N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine?
N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine has a molecular weight of 223.36 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethyl-N-propan-2-yl-4-propan-2-yloxycyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 139474349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).