C21H33NO — CID 139474556
(1S,2R,14R)-14-ethanimidoyl-2,11-dimethyltricyclo[8.7.0.02,7]heptadec-6-en-5-one (PubChem CID 139474556) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is (1S,2R,14R)-14-ethanimidoyl-2,11-dimethyltricyclo[8.7.0.02,7]heptadec-6-en-5-one.
| Compound Name | (1S,2R,14R)-14-ethanimidoyl-2,11-dimethyltricyclo[8.7.0.02,7]heptadec-6-en-5-one |
|---|---|
| PubChem CID | 139474556 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (1S,2R,14R)-14-ethanimidoyl-2,11-dimethyltricyclo[8.7.0.02,7]heptadec-6-en-5-one |
| SMILES | [H]/N=C(\C)[C@@H]1CCC[C@H]2C(CCC3=CC(=O)CC[C@@]32C)C(C)CC1 |
| InChI | InChI=1S/C21H33NO/c1-14-7-8-16(15(2)22)5-4-6-20-19(14)10-9-17-13-18(23)11-12-21(17,20)3/h13-14,16,19-20,22H,4-12H2,1-3H3/b22-15+/t14?,16-,19?,20+,21+/m1/s1 |
| InChIKey | NQSNPXMQYSRGRD-ZZZWMMPJSA-N |
| XLogP | 5.56 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|