C19H26N4O4 — CID 139474584
1-[3-[(1R,5S)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]-3-oxopropyl]pyrimidine-2,4-dione (PubChem CID 139474584) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-[3-[(1R,5S)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]-3-oxopropyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[(1R,5S)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]-3-oxopropyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139474584 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-[3-[(1R,5S)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]-3-oxopropyl]pyrimidine-2,4-dione |
| SMILES | CC(C)=CCN1C(=O)[C@@H]2CC[C@H]1CN(C(=O)CCn1ccc(=O)[nH]c1=O)C2 |
| InChI | InChI=1S/C19H26N4O4/c1-13(2)5-10-23-15-4-3-14(18(23)26)11-22(12-15)17(25)7-9-21-8-6-16(24)20-19(21)27/h5-6,8,14-15H,3-4,7,9-12H2,1-2H3,(H,20,24,27)/t14-,15+/m1/s1 |
| InChIKey | WZLMZNPHIRDJBE-CABCVRRESA-N |
| XLogP | 0.34 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|