C13H20F2N2 — CID 139474751
(2E,5E)-7,7-difluoro-1-imino-3,4,6,8-tetramethylnona-2,5,8-trien-2-amine (PubChem CID 139474751) has the molecular formula C13H20F2N2 and a molecular weight of 242.31 g/mol. Its IUPAC name is (2E,5E)-7,7-difluoro-1-imino-3,4,6,8-tetramethylnona-2,5,8-trien-2-amine.
| Compound Name | (2E,5E)-7,7-difluoro-1-imino-3,4,6,8-tetramethylnona-2,5,8-trien-2-amine |
|---|---|
| PubChem CID | 139474751 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (2E,5E)-7,7-difluoro-1-imino-3,4,6,8-tetramethylnona-2,5,8-trien-2-amine |
| SMILES | [H]/N=C/C(N)=C(/C)C(C)/C=C(\C)C(F)(F)C(=C)C |
| InChI | InChI=1S/C13H20F2N2/c1-8(2)13(14,15)10(4)6-9(3)11(5)12(17)7-16/h6-7,9,16H,1,17H2,2-5H3/b10-6+,12-11+,16-7+ |
| InChIKey | JHKZEEUEJYITFF-KYUHKGJESA-N |
| XLogP | 3.66 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|