About 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine
4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine (PubChem CID 139475018) has the molecular formula C9H17F2N3
and a molecular weight of 205.25 g/mol. Its IUPAC name is 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine |
| PubChem CID | 139475018 |
| Molecular Formula | C9H17F2N3 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine |
| SMILES | CN1CC(N)C(C2C(N)CC2(F)F)C1 |
| InChI | InChI=1S/C9H17F2N3/c1-14-3-5(7(13)4-14)8-6(12)2-9(8,10)11/h5-8H,2-4,12-13H2,1H3 |
| InChIKey | HPONZYJFJFJZHA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine?
The IUPAC name of 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine (CID 139475018) is 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine.
What is the SMILES notation for 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine?
The canonical SMILES for 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine is CN1CC(N)C(C2C(N)CC2(F)F)C1.
What is the InChIKey of 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine?
The InChIKey is HPONZYJFJFJZHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2N3/c1-14-3-5(7(13)4-14)8-6(12)2-9(8,10)11/h5-8H,2-4,12-13H2,1H3.
What are the key properties of 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine?
4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine has a molecular weight of 205.25 g/mol, XLogP of -0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-2,2-difluorocyclobutyl)-1-methylpyrrolidin-3-amine is sourced from PubChem (CID 139475018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).