About 1-tert-butylsulfonyl-3,3-difluoroazetidine
1-tert-butylsulfonyl-3,3-difluoroazetidine (PubChem CID 139475227) has the molecular formula C7H13F2NO2S
and a molecular weight of 213.25 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-3,3-difluoroazetidine.
Molecular Properties
| Compound Name | 1-tert-butylsulfonyl-3,3-difluoroazetidine |
| PubChem CID | 139475227 |
| Molecular Formula | C7H13F2NO2S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-tert-butylsulfonyl-3,3-difluoroazetidine |
| SMILES | CC(C)(C)S(=O)(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C7H13F2NO2S/c1-6(2,3)13(11,12)10-4-7(8,9)5-10/h4-5H2,1-3H3 |
| InChIKey | OSZFWLBVBUHWEQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylsulfonyl-3,3-difluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfonyl-3,3-difluoroazetidine?
The IUPAC name of 1-tert-butylsulfonyl-3,3-difluoroazetidine (CID 139475227) is 1-tert-butylsulfonyl-3,3-difluoroazetidine.
What is the SMILES notation for 1-tert-butylsulfonyl-3,3-difluoroazetidine?
The canonical SMILES for 1-tert-butylsulfonyl-3,3-difluoroazetidine is CC(C)(C)S(=O)(=O)N1CC(F)(F)C1.
What is the InChIKey of 1-tert-butylsulfonyl-3,3-difluoroazetidine?
The InChIKey is OSZFWLBVBUHWEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2NO2S/c1-6(2,3)13(11,12)10-4-7(8,9)5-10/h4-5H2,1-3H3.
What are the key properties of 1-tert-butylsulfonyl-3,3-difluoroazetidine?
1-tert-butylsulfonyl-3,3-difluoroazetidine has a molecular weight of 213.25 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfonyl-3,3-difluoroazetidine is sourced from PubChem (CID 139475227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).