C20H40N2O — CID 139475383
(3aS,6aR)-5-tert-butyl-2-[3-(2,2-dimethylpropoxy)propyl]-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole (PubChem CID 139475383) has the molecular formula C20H40N2O and a molecular weight of 324.55 g/mol. Its IUPAC name is (3aS,6aR)-5-tert-butyl-2-[3-(2,2-dimethylpropoxy)propyl]-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-tert-butyl-2-[3-(2,2-dimethylpropoxy)propyl]-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 139475383 |
| Molecular Formula | C20H40N2O |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.31 |
| IUPAC Name | (3aS,6aR)-5-tert-butyl-2-[3-(2,2-dimethylpropoxy)propyl]-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)(C)COCCCN1C[C@@]2(C)CN(C(C)(C)C)C[C@@]2(C)C1 |
| InChI | InChI=1S/C20H40N2O/c1-17(2,3)16-23-11-9-10-21-12-19(7)14-22(18(4,5)6)15-20(19,8)13-21/h9-16H2,1-8H3/t19-,20+ |
| InChIKey | MVFCKTNFXBYZCA-BGYRXZFFSA-N |
| XLogP | 3.88 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|