About 3-but-3-en-2-yl-1,2,4-oxadiazole
3-but-3-en-2-yl-1,2,4-oxadiazole (PubChem CID 139475481) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 3-but-3-en-2-yl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-but-3-en-2-yl-1,2,4-oxadiazole |
| PubChem CID | 139475481 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 3-but-3-en-2-yl-1,2,4-oxadiazole |
| SMILES | C=CC(C)c1ncon1 |
| InChI | InChI=1S/C6H8N2O/c1-3-5(2)6-7-4-9-8-6/h3-5H,1H2,2H3 |
| InChIKey | XBDMESIEKMNABM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-en-2-yl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-en-2-yl-1,2,4-oxadiazole?
The IUPAC name of 3-but-3-en-2-yl-1,2,4-oxadiazole (CID 139475481) is 3-but-3-en-2-yl-1,2,4-oxadiazole.
What is the SMILES notation for 3-but-3-en-2-yl-1,2,4-oxadiazole?
The canonical SMILES for 3-but-3-en-2-yl-1,2,4-oxadiazole is C=CC(C)c1ncon1.
What is the InChIKey of 3-but-3-en-2-yl-1,2,4-oxadiazole?
The InChIKey is XBDMESIEKMNABM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c1-3-5(2)6-7-4-9-8-6/h3-5H,1H2,2H3.
What are the key properties of 3-but-3-en-2-yl-1,2,4-oxadiazole?
3-but-3-en-2-yl-1,2,4-oxadiazole has a molecular weight of 124.14 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-en-2-yl-1,2,4-oxadiazole is sourced from PubChem (CID 139475481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).