C11H14O7 — CID 139475922
[(6R,7S,7aS)-7-acetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate (PubChem CID 139475922) has the molecular formula C11H14O7 and a molecular weight of 258.23 g/mol. Its IUPAC name is [(6R,7S,7aS)-7-acetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate.
| Compound Name | [(6R,7S,7aS)-7-acetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate |
|---|---|
| PubChem CID | 139475922 |
| Molecular Formula | C11H14O7 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | [(6R,7S,7aS)-7-acetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)COC2CC(=O)O[C@@H]21 |
| InChI | InChI=1S/C11H14O7/c1-5(12)16-8-4-15-7-3-9(14)18-10(7)11(8)17-6(2)13/h7-8,10-11H,3-4H2,1-2H3/t7?,8-,10+,11+/m1/s1 |
| InChIKey | COOSSPGZEFETRV-NGJJGHSNSA-N |
| XLogP | -0.44 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|