C15H22N2 — CID 139476021
(2Z,7Z)-4-N,6-N-bis(ethenyl)-5,5-dimethylnona-2,7-diene-4,6-diimine (PubChem CID 139476021) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (2Z,7Z)-4-N,6-N-bis(ethenyl)-5,5-dimethylnona-2,7-diene-4,6-diimine.
| Compound Name | (2Z,7Z)-4-N,6-N-bis(ethenyl)-5,5-dimethylnona-2,7-diene-4,6-diimine |
|---|---|
| PubChem CID | 139476021 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (2Z,7Z)-4-N,6-N-bis(ethenyl)-5,5-dimethylnona-2,7-diene-4,6-diimine |
| SMILES | C=C/N=C(\C=C/C)C(C)(C)C(/C=C\C)=N/C=C |
| InChI | InChI=1S/C15H22N2/c1-7-11-13(16-9-3)15(5,6)14(12-8-2)17-10-4/h7-12H,3-4H2,1-2,5-6H3/b11-7-,12-8-,16-13+,17-14+ |
| InChIKey | HEIYMTXUYFRVDP-YRJXCSIESA-N |
| XLogP | 4.33 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|