C32H42ClNO5 — CID 139476834
3-[3-(4-chloro-2-propylphenyl)-5-hex-5-enyl-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 139476834) has the molecular formula C32H42ClNO5 and a molecular weight of 556.14 g/mol. Its IUPAC name is 3-[3-(4-chloro-2-propylphenyl)-5-hex-5-enyl-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | 3-[3-(4-chloro-2-propylphenyl)-5-hex-5-enyl-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139476834 |
| Molecular Formula | C32H42ClNO5 |
| Molecular Weight | 556.14 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | 3-[3-(4-chloro-2-propylphenyl)-5-hex-5-enyl-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | C=CCCCCN1CC(c2ccc(Cl)cc2CCC)COc2ccc(C(CC(=O)O)C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C32H42ClNO5/c1-6-8-9-10-16-34-20-24(26-14-13-25(33)17-22(26)11-7-2)21-38-29-15-12-23(18-28(29)34)27(19-30(35)36)31(37)39-32(3,4)5/h6,12-15,17-18,24,27H,1,7-11,16,19-21H2,2-5H3,(H,35,36) |
| InChIKey | JISNMHZXGWTZCO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.14 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|