C26H31F2NO4 — CID 139477108
3-[2-(2,2-difluoropropoxy)acetyl]-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139477108) has the molecular formula C26H31F2NO4 and a molecular weight of 459.53 g/mol. Its IUPAC name is 3-[2-(2,2-difluoropropoxy)acetyl]-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 3-[2-(2,2-difluoropropoxy)acetyl]-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139477108 |
| Molecular Formula | C26H31F2NO4 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 3-[2-(2,2-difluoropropoxy)acetyl]-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)COCC(C)(F)F)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C26H31F2NO4/c1-5-6-19-11-17(2)23(18(3)12-19)24-20(30)13-26(14-21(24)31)7-9-29(10-8-26)22(32)15-33-16-25(4,27)28/h11-12,24H,7-10,13-16H2,1-4H3 |
| InChIKey | VWIJTRUROXRAJH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|