C23H29F2NO4 — CID 139477268
3-[2-(difluoromethoxy)propanoyl]-9-(2,4,6-trimethylphenyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139477268) has the molecular formula C23H29F2NO4 and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)propanoyl]-9-(2,4,6-trimethylphenyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 3-[2-(difluoromethoxy)propanoyl]-9-(2,4,6-trimethylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139477268 |
| Molecular Formula | C23H29F2NO4 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 3-[2-(difluoromethoxy)propanoyl]-9-(2,4,6-trimethylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)C(C)OC(F)F)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C23H29F2NO4/c1-13-9-14(2)19(15(3)10-13)20-17(27)11-23(12-18(20)28)5-7-26(8-6-23)21(29)16(4)30-22(24)25/h9-10,16,20,22H,5-8,11-12H2,1-4H3 |
| InChIKey | DKEOWZTZLAMPOB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|