C30H35N9O3 — CID 139477357
tert-butyl N-[(3S)-4-azido-1-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-1-methylbenzimidazole-5-carbonyl]piperidin-3-yl]carbamate (PubChem CID 139477357) has the molecular formula C30H35N9O3 and a molecular weight of 569.67 g/mol. Its IUPAC name is tert-butyl N-[(3S)-4-azido-1-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-1-methylbenzimidazole-5-carbonyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-4-azido-1-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-1-methylbenzimidazole-5-carbonyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 139477357 |
| Molecular Formula | C30H35N9O3 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | tert-butyl N-[(3S)-4-azido-1-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-1-methylbenzimidazole-5-carbonyl]piperidin-3-yl]carbamate |
| SMILES | Cn1c(-c2cc3cccnc3n2CC2CC2)nc2cc(C(=O)N3CCC(N=[N+]=[N-])[C@@H](NC(=O)OC(C)(C)C)C3)ccc21 |
| InChI | InChI=1S/C30H35N9O3/c1-30(2,3)42-29(41)34-23-17-38(13-11-21(23)35-36-31)28(40)20-9-10-24-22(14-20)33-27(37(24)4)25-15-19-6-5-12-32-26(19)39(25)16-18-7-8-18/h5-6,9-10,12,14-15,18,21,23H,7-8,11,13,16-17H2,1-4H3,(H,34,41)/t21?,23-/m0/s1 |
| InChIKey | SCRUOUMWKYUECI-YANBTOMASA-N |
| XLogP | 5.42 |
| TPSA | 143.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|