About (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide
(E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide (PubChem CID 139477713) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide |
| PubChem CID | 139477713 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide |
| SMILES | C/C=C/C(=O)N[C@@H]1CNC[C@H]1NC(C)CCC |
| InChI | InChI=1S/C13H25N3O/c1-4-6-10(3)15-11-8-14-9-12(11)16-13(17)7-5-2/h5,7,10-12,14-15H,4,6,8-9H2,1-3H3,(H,16,17)/b7-5+/t10?,11-,12-/m1/s1 |
| InChIKey | YJYYPJKUQOALLU-KCFNYYQPSA-N |
| XLogP | 0.80 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide?
The IUPAC name of (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide (CID 139477713) is (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide.
What is the SMILES notation for (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide?
The canonical SMILES for (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide is C/C=C/C(=O)N[C@@H]1CNC[C@H]1NC(C)CCC.
What is the InChIKey of (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide?
The InChIKey is YJYYPJKUQOALLU-KCFNYYQPSA-N. The full InChI is InChI=1S/C13H25N3O/c1-4-6-10(3)15-11-8-14-9-12(11)16-13(17)7-5-2/h5,7,10-12,14-15H,4,6,8-9H2,1-3H3,(H,16,17)/b7-5+/t10?,11-,12-/m1/s1.
What are the key properties of (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide?
(E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide has a molecular weight of 239.36 g/mol, XLogP of 0.80, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(3R,4R)-4-(pentan-2-ylamino)pyrrolidin-3-yl]but-2-enamide is sourced from PubChem (CID 139477713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).