C15H25N5O2S — CID 139477788
tert-butyl N-[2-[(E)-N-amino-N-phenylcarbamohydrazonoyl]sulfanylethyl]-N-methylcarbamate (PubChem CID 139477788) has the molecular formula C15H25N5O2S and a molecular weight of 339.47 g/mol. Its IUPAC name is tert-butyl N-[2-[(E)-N-amino-N-phenylcarbamohydrazonoyl]sulfanylethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(E)-N-amino-N-phenylcarbamohydrazonoyl]sulfanylethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 139477788 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | tert-butyl N-[2-[(E)-N-amino-N-phenylcarbamohydrazonoyl]sulfanylethyl]-N-methylcarbamate |
| SMILES | CN(CCS/C(=N/N)N(N)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N5O2S/c1-15(2,3)22-14(21)19(4)10-11-23-13(18-16)20(17)12-8-6-5-7-9-12/h5-9H,10-11,16-17H2,1-4H3/b18-13+ |
| InChIKey | RTTITCYFJZTLCA-QGOAFFKASA-N |
| XLogP | 2.20 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|