About 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole
5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole (PubChem CID 139477941) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole |
| PubChem CID | 139477941 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole |
| SMILES | CC/C=C\C1=NN(C)CC1 |
| InChI | InChI=1S/C8H14N2/c1-3-4-5-8-6-7-10(2)9-8/h4-5H,3,6-7H2,1-2H3/b5-4- |
| InChIKey | KTRCECHASWRNID-PLNGDYQASA-N |
| XLogP | 1.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole?
The IUPAC name of 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole (CID 139477941) is 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole.
What is the SMILES notation for 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole?
The canonical SMILES for 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole is CC/C=C\C1=NN(C)CC1.
What is the InChIKey of 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole?
The InChIKey is KTRCECHASWRNID-PLNGDYQASA-N. The full InChI is InChI=1S/C8H14N2/c1-3-4-5-8-6-7-10(2)9-8/h4-5H,3,6-7H2,1-2H3/b5-4-.
What are the key properties of 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole?
5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole has a molecular weight of 138.21 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-but-1-enyl]-2-methyl-3,4-dihydropyrazole is sourced from PubChem (CID 139477941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).