C22H27ClN4O4 — CID 139478314
(10R)-5-[(4-chlorophenyl)methyl]-8-(3-hydroxypropyl)-4-propan-2-yloxy-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione (PubChem CID 139478314) has the molecular formula C22H27ClN4O4 and a molecular weight of 446.94 g/mol. Its IUPAC name is (10R)-5-[(4-chlorophenyl)methyl]-8-(3-hydroxypropyl)-4-propan-2-yloxy-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione.
| Compound Name | (10R)-5-[(4-chlorophenyl)methyl]-8-(3-hydroxypropyl)-4-propan-2-yloxy-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
|---|---|
| PubChem CID | 139478314 |
| Molecular Formula | C22H27ClN4O4 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (10R)-5-[(4-chlorophenyl)methyl]-8-(3-hydroxypropyl)-4-propan-2-yloxy-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
| SMILES | CC(C)Oc1nc2c(n1Cc1ccc(Cl)cc1)C(=O)N(CCCO)C(=O)[C@H]1CCCN21 |
| InChI | InChI=1S/C22H27ClN4O4/c1-14(2)31-22-24-19-18(27(22)13-15-6-8-16(23)9-7-15)21(30)26(11-4-12-28)20(29)17-5-3-10-25(17)19/h6-9,14,17,28H,3-5,10-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | WIGKOBHJULXDSA-QGZVFWFLSA-N |
| XLogP | 2.71 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|