About N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide
N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide (PubChem CID 139478325) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide.
Molecular Properties
| Compound Name | N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide |
| PubChem CID | 139478325 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CCC(C)NS(=O)(=O)C1=CCCC=C1 |
| InChI | InChI=1S/C10H17NO2S/c1-3-9(2)11-14(12,13)10-7-5-4-6-8-10/h5,7-9,11H,3-4,6H2,1-2H3 |
| InChIKey | NPEZGJGIQQTSLE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide?
The IUPAC name of N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide (CID 139478325) is N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide.
What is the SMILES notation for N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide?
The canonical SMILES for N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide is CCC(C)NS(=O)(=O)C1=CCCC=C1.
What is the InChIKey of N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide?
The InChIKey is NPEZGJGIQQTSLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S/c1-3-9(2)11-14(12,13)10-7-5-4-6-8-10/h5,7-9,11H,3-4,6H2,1-2H3.
What are the key properties of N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide?
N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide has a molecular weight of 215.32 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylcyclohexa-1,5-diene-1-sulfonamide is sourced from PubChem (CID 139478325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).