C24H23ClFN5O4 — CID 139478331
5-[(5-chloro-2-pyridinyl)methyl]-4-(3-fluorophenoxy)-8-(3-hydroxypropyl)-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione (PubChem CID 139478331) has the molecular formula C24H23ClFN5O4 and a molecular weight of 499.93 g/mol. Its IUPAC name is 5-[(5-chloro-2-pyridinyl)methyl]-4-(3-fluorophenoxy)-8-(3-hydroxypropyl)-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione.
| Compound Name | 5-[(5-chloro-2-pyridinyl)methyl]-4-(3-fluorophenoxy)-8-(3-hydroxypropyl)-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
|---|---|
| PubChem CID | 139478331 |
| Molecular Formula | C24H23ClFN5O4 |
| Molecular Weight | 499.93 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 5-[(5-chloro-2-pyridinyl)methyl]-4-(3-fluorophenoxy)-8-(3-hydroxypropyl)-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
| SMILES | O=C1c2c(nc(Oc3cccc(F)c3)n2Cc2ccc(Cl)cn2)N2CCCC2C(=O)N1CCCO |
| InChI | InChI=1S/C24H23ClFN5O4/c25-15-7-8-17(27-13-15)14-31-20-21(28-24(31)35-18-5-1-4-16(26)12-18)29-9-2-6-19(29)22(33)30(23(20)34)10-3-11-32/h1,4-5,7-8,12-13,19,32H,2-3,6,9-11,14H2 |
| InChIKey | RGOJVYMHFHBJQT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.93 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|