About 2,5-difluoro-3H-imidazo[1,5-a]pyridine
2,5-difluoro-3H-imidazo[1,5-a]pyridine (PubChem CID 139478688) has the molecular formula C7H6F2N2
and a molecular weight of 156.14 g/mol. Its IUPAC name is 2,5-difluoro-3H-imidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 2,5-difluoro-3H-imidazo[1,5-a]pyridine |
| PubChem CID | 139478688 |
| Molecular Formula | C7H6F2N2 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2,5-difluoro-3H-imidazo[1,5-a]pyridine |
| SMILES | FC1=CC=CC2=CN(F)CN12 |
| InChI | InChI=1S/C7H6F2N2/c8-7-3-1-2-6-4-10(9)5-11(6)7/h1-4H,5H2 |
| InChIKey | GVUJARRFPKOVEV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,5-difluoro-3H-imidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoro-3H-imidazo[1,5-a]pyridine?
The IUPAC name of 2,5-difluoro-3H-imidazo[1,5-a]pyridine (CID 139478688) is 2,5-difluoro-3H-imidazo[1,5-a]pyridine.
What is the SMILES notation for 2,5-difluoro-3H-imidazo[1,5-a]pyridine?
The canonical SMILES for 2,5-difluoro-3H-imidazo[1,5-a]pyridine is FC1=CC=CC2=CN(F)CN12.
What is the InChIKey of 2,5-difluoro-3H-imidazo[1,5-a]pyridine?
The InChIKey is GVUJARRFPKOVEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2N2/c8-7-3-1-2-6-4-10(9)5-11(6)7/h1-4H,5H2.
What are the key properties of 2,5-difluoro-3H-imidazo[1,5-a]pyridine?
2,5-difluoro-3H-imidazo[1,5-a]pyridine has a molecular weight of 156.14 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-3H-imidazo[1,5-a]pyridine is sourced from PubChem (CID 139478688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).