About (3R)-1,3-dimethylpyrrolidine-2,5-dione
(3R)-1,3-dimethylpyrrolidine-2,5-dione (PubChem CID 1394791) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is (3R)-1,3-dimethylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | (3R)-1,3-dimethylpyrrolidine-2,5-dione |
| PubChem CID | 1394791 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (3R)-1,3-dimethylpyrrolidine-2,5-dione |
| SMILES | C[C@@H]1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C6H9NO2/c1-4-3-5(8)7(2)6(4)9/h4H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | NIXKACOKLPRDMY-SCSAIBSYSA-N |
| XLogP | 0.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1,3-dimethylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,3-dimethylpyrrolidine-2,5-dione?
The IUPAC name of (3R)-1,3-dimethylpyrrolidine-2,5-dione (CID 1394791) is (3R)-1,3-dimethylpyrrolidine-2,5-dione.
What is the SMILES notation for (3R)-1,3-dimethylpyrrolidine-2,5-dione?
The canonical SMILES for (3R)-1,3-dimethylpyrrolidine-2,5-dione is C[C@@H]1CC(=O)N(C)C1=O.
What is the InChIKey of (3R)-1,3-dimethylpyrrolidine-2,5-dione?
The InChIKey is NIXKACOKLPRDMY-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-3-5(8)7(2)6(4)9/h4H,3H2,1-2H3/t4-/m1/s1.
What are the key properties of (3R)-1,3-dimethylpyrrolidine-2,5-dione?
(3R)-1,3-dimethylpyrrolidine-2,5-dione has a molecular weight of 127.14 g/mol, XLogP of 0.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,3-dimethylpyrrolidine-2,5-dione is sourced from PubChem (CID 1394791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).