About (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene
(E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene (PubChem CID 139479459) has the molecular formula C12H21F
and a molecular weight of 184.30 g/mol. Its IUPAC name is (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene.
Molecular Properties
| Compound Name | (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene |
| PubChem CID | 139479459 |
| Molecular Formula | C12H21F |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene |
| SMILES | C=CC(C/C=C(\C)F)C(C)C(C)C |
| InChI | InChI=1S/C12H21F/c1-6-12(8-7-10(4)13)11(5)9(2)3/h6-7,9,11-12H,1,8H2,2-5H3/b10-7+ |
| InChIKey | KHDGJUPARVJCJM-JXMROGBWSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene?
The IUPAC name of (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene (CID 139479459) is (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene.
What is the SMILES notation for (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene?
The canonical SMILES for (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene is C=CC(C/C=C(\C)F)C(C)C(C)C.
What is the InChIKey of (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene?
The InChIKey is KHDGJUPARVJCJM-JXMROGBWSA-N. The full InChI is InChI=1S/C12H21F/c1-6-12(8-7-10(4)13)11(5)9(2)3/h6-7,9,11-12H,1,8H2,2-5H3/b10-7+.
What are the key properties of (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene?
(E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene has a molecular weight of 184.30 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-ethenyl-2-fluoro-6,7-dimethyloct-2-ene is sourced from PubChem (CID 139479459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).