About 4-ethyl-1,2-dihydro-2,6-naphthyridine
4-ethyl-1,2-dihydro-2,6-naphthyridine (PubChem CID 139479498) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-ethyl-1,2-dihydro-2,6-naphthyridine.
Molecular Properties
| Compound Name | 4-ethyl-1,2-dihydro-2,6-naphthyridine |
| PubChem CID | 139479498 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-ethyl-1,2-dihydro-2,6-naphthyridine |
| SMILES | CCC1=CNCc2ccncc21 |
| InChI | InChI=1S/C10H12N2/c1-2-8-5-12-6-9-3-4-11-7-10(8)9/h3-5,7,12H,2,6H2,1H3 |
| InChIKey | ZRWWQBFBJVBLBO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1,2-dihydro-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,2-dihydro-2,6-naphthyridine?
The IUPAC name of 4-ethyl-1,2-dihydro-2,6-naphthyridine (CID 139479498) is 4-ethyl-1,2-dihydro-2,6-naphthyridine.
What is the SMILES notation for 4-ethyl-1,2-dihydro-2,6-naphthyridine?
The canonical SMILES for 4-ethyl-1,2-dihydro-2,6-naphthyridine is CCC1=CNCc2ccncc21.
What is the InChIKey of 4-ethyl-1,2-dihydro-2,6-naphthyridine?
The InChIKey is ZRWWQBFBJVBLBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-8-5-12-6-9-3-4-11-7-10(8)9/h3-5,7,12H,2,6H2,1H3.
What are the key properties of 4-ethyl-1,2-dihydro-2,6-naphthyridine?
4-ethyl-1,2-dihydro-2,6-naphthyridine has a molecular weight of 160.22 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,2-dihydro-2,6-naphthyridine is sourced from PubChem (CID 139479498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).