C18H19ClF3N5O — CID 139480289
N-[(2S)-1-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide (PubChem CID 139480289) has the molecular formula C18H19ClF3N5O and a molecular weight of 413.83 g/mol. Its IUPAC name is N-[(2S)-1-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-1-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 139480289 |
| Molecular Formula | C18H19ClF3N5O |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[(2S)-1-[(3Z,5Z)-6-aminohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide |
| SMILES | C=C(/C=C\C=C/N)/N=C(\N=C\N)[C@H](C)NC(=O)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19ClF3N5O/c1-11(5-3-4-6-23)26-16(25-10-24)12(2)27-17(28)13-7-14(18(20,21)22)9-15(19)8-13/h3-10,12H,1,23H2,2H3,(H,27,28)(H2,24,25,26)/b5-3-,6-4-/t12-/m0/s1 |
| InChIKey | PYVMRZQJCBACAO-QLZKUNRISA-N |
| XLogP | 3.40 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|