C39H48O6 — CID 139480593
1,1,1',1'-tetramethyl-4,4',5,5',6,6'-hexakis(prop-2-enoxy)-3,3'-spirobi[2H-indene] (PubChem CID 139480593) has the molecular formula C39H48O6 and a molecular weight of 612.81 g/mol. Its IUPAC name is 1,1,1',1'-tetramethyl-4,4',5,5',6,6'-hexakis(prop-2-enoxy)-3,3'-spirobi[2H-indene].
| Compound Name | 1,1,1',1'-tetramethyl-4,4',5,5',6,6'-hexakis(prop-2-enoxy)-3,3'-spirobi[2H-indene] |
|---|---|
| PubChem CID | 139480593 |
| Molecular Formula | C39H48O6 |
| Molecular Weight | 612.81 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | 1,1,1',1'-tetramethyl-4,4',5,5',6,6'-hexakis(prop-2-enoxy)-3,3'-spirobi[2H-indene] |
| SMILES | C=CCOc1cc2c(c(OCC=C)c1OCC=C)C1(CC2(C)C)CC(C)(C)c2cc(OCC=C)c(OCC=C)c(OCC=C)c21 |
| InChI | InChI=1S/C39H48O6/c1-11-17-40-29-23-27-31(35(44-21-15-5)33(29)42-19-13-3)39(25-37(27,7)8)26-38(9,10)28-24-30(41-18-12-2)34(43-20-14-4)36(32(28)39)45-22-16-6/h11-16,23-24H,1-6,17-22,25-26H2,7-10H3 |
| InChIKey | TVTLLQXCAGQOFI-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.81 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|