About S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine
S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine (PubChem CID 139480669) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine.
Molecular Properties
| Compound Name | S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine |
| PubChem CID | 139480669 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine |
| SMILES | C/C=C\C=C(/SN)C(C)C |
| InChI | InChI=1S/C8H15NS/c1-4-5-6-8(10-9)7(2)3/h4-7H,9H2,1-3H3/b5-4-,8-6- |
| InChIKey | FAGPANAESYBVIQ-NADLECRISA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine?
The IUPAC name of S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine (CID 139480669) is S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine.
What is the SMILES notation for S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine?
The canonical SMILES for S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine is C/C=C\C=C(/SN)C(C)C.
What is the InChIKey of S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine?
The InChIKey is FAGPANAESYBVIQ-NADLECRISA-N. The full InChI is InChI=1S/C8H15NS/c1-4-5-6-8(10-9)7(2)3/h4-7H,9H2,1-3H3/b5-4-,8-6-.
What are the key properties of S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine?
S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine has a molecular weight of 157.28 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]thiohydroxylamine is sourced from PubChem (CID 139480669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).