C18H18Cl2F3N5O — CID 139480883
N-[(2S)-1-[(3E,5Z)-6-amino-3-chlorohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide (PubChem CID 139480883) has the molecular formula C18H18Cl2F3N5O and a molecular weight of 448.28 g/mol. Its IUPAC name is N-[(2S)-1-[(3E,5Z)-6-amino-3-chlorohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-1-[(3E,5Z)-6-amino-3-chlorohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 139480883 |
| Molecular Formula | C18H18Cl2F3N5O |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-[(2S)-1-[(3E,5Z)-6-amino-3-chlorohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-5-(trifluoromethyl)benzamide |
| SMILES | C=C(/N=C(/N=C/N)[C@H](C)NC(=O)c1cc(Cl)cc(C(F)(F)F)c1)/C(Cl)=C\C=C/N |
| InChI | InChI=1S/C18H18Cl2F3N5O/c1-10(15(20)4-3-5-24)27-16(26-9-25)11(2)28-17(29)12-6-13(18(21,22)23)8-14(19)7-12/h3-9,11H,1,24H2,2H3,(H,28,29)(H2,25,26,27)/b5-3-,15-4+/t11-/m0/s1 |
| InChIKey | HPXIFWNHIYJBPM-GHGZOSPJSA-N |
| XLogP | 3.97 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|