C22H24ClF4N5O — CID 139480902
N-[1-[(3E,5Z)-6-amino-3-fluorohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-N-(cyclopropylmethyl)-5-(trifluoromethyl)benzamide (PubChem CID 139480902) has the molecular formula C22H24ClF4N5O and a molecular weight of 485.91 g/mol. Its IUPAC name is N-[1-[(3E,5Z)-6-amino-3-fluorohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-N-(cyclopropylmethyl)-5-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[(3E,5Z)-6-amino-3-fluorohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-N-(cyclopropylmethyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 139480902 |
| Molecular Formula | C22H24ClF4N5O |
| Molecular Weight | 485.91 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[1-[(3E,5Z)-6-amino-3-fluorohexa-1,3,5-trien-2-yl]imino-1-(aminomethylideneamino)propan-2-yl]-3-chloro-N-(cyclopropylmethyl)-5-(trifluoromethyl)benzamide |
| SMILES | C=C(/N=C(/N=C/N)C(C)N(CC1CC1)C(=O)c1cc(Cl)cc(C(F)(F)F)c1)/C(F)=C\C=C/N |
| InChI | InChI=1S/C22H24ClF4N5O/c1-13(19(24)4-3-7-28)31-20(30-12-29)14(2)32(11-15-5-6-15)21(33)16-8-17(22(25,26)27)10-18(23)9-16/h3-4,7-10,12,14-15H,1,5-6,11,28H2,2H3,(H2,29,30,31)/b7-3-,19-4+ |
| InChIKey | UUDKCQWNGSYSBI-YLQYCGBPSA-N |
| XLogP | 4.82 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.91 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|